C18H31N5O3S — CID 130425774
(2S)-2-[1-(ethylamino)ethenylamino]-N-[(6E,8S,11R)-8-methyl-10-methylidene-1,5-dioxo-1λ4-thia-4,9-diazacyclododec-6-en-11-yl]propanamide (PubChem CID 130425774) has the molecular formula C18H31N5O3S and a molecular weight of 397.55 g/mol. Its IUPAC name is (2S)-2-[1-(ethylamino)ethenylamino]-N-[(6E,8S,11R)-8-methyl-10-methylidene-1,5-dioxo-1λ4-thia-4,9-diazacyclododec-6-en-11-yl]propanamide.
| Compound Name | (2S)-2-[1-(ethylamino)ethenylamino]-N-[(6E,8S,11R)-8-methyl-10-methylidene-1,5-dioxo-1λ4-thia-4,9-diazacyclododec-6-en-11-yl]propanamide |
|---|---|
| PubChem CID | 130425774 |
| Molecular Formula | C18H31N5O3S |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (2S)-2-[1-(ethylamino)ethenylamino]-N-[(6E,8S,11R)-8-methyl-10-methylidene-1,5-dioxo-1λ4-thia-4,9-diazacyclododec-6-en-11-yl]propanamide |
| SMILES | C=C(NCC)N[C@@H](C)C(=O)N[C@H]1CS(=O)CCNC(=O)/C=C/[C@H](C)NC1=C |
| InChI | InChI=1S/C18H31N5O3S/c1-6-19-15(5)22-14(4)18(25)23-16-11-27(26)10-9-20-17(24)8-7-12(2)21-13(16)3/h7-8,12,14,16,19,21-22H,3,5-6,9-11H2,1-2,4H3,(H,20,24)(H,23,25)/b8-7+/t12-,14-,16-,27?/m0/s1 |
| InChIKey | QTTTUDVPOOMOAJ-ZXQGLMFISA-N |
| XLogP | -0.54 |
| TPSA | 111.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |