C16H26N4O5S — CID 137478914
[3-methyl-1-[[(6E,8S,11R)-8-methyl-5,10-dioxo-1-thia-4,9-diazacyclododec-6-en-11-yl]amino]-1-oxobutan-2-yl]carbamic acid (PubChem CID 137478914) has the molecular formula C16H26N4O5S and a molecular weight of 386.47 g/mol. Its IUPAC name is [3-methyl-1-[[(6E,8S,11R)-8-methyl-5,10-dioxo-1-thia-4,9-diazacyclododec-6-en-11-yl]amino]-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [3-methyl-1-[[(6E,8S,11R)-8-methyl-5,10-dioxo-1-thia-4,9-diazacyclododec-6-en-11-yl]amino]-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 137478914 |
| Molecular Formula | C16H26N4O5S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [3-methyl-1-[[(6E,8S,11R)-8-methyl-5,10-dioxo-1-thia-4,9-diazacyclododec-6-en-11-yl]amino]-1-oxobutan-2-yl]carbamic acid |
| SMILES | CC(C)C(NC(=O)O)C(=O)N[C@H]1CSCCNC(=O)/C=C/[C@H](C)NC1=O |
| InChI | InChI=1S/C16H26N4O5S/c1-9(2)13(20-16(24)25)15(23)19-11-8-26-7-6-17-12(21)5-4-10(3)18-14(11)22/h4-5,9-11,13,20H,6-8H2,1-3H3,(H,17,21)(H,18,22)(H,19,23)(H,24,25)/b5-4+/t10-,11-,13?/m0/s1 |
| InChIKey | MESRFBKNGXWIHO-SBAJXKRPSA-N |
| XLogP | -0.31 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |