C24H39N5O6 — CID 132561077
(2S)-2-[[(2S)-1-[[(3E,5S,8S,10E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,10-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoic acid (PubChem CID 132561077) has the molecular formula C24H39N5O6 and a molecular weight of 493.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-[[(3E,5S,8S,10E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,10-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-[[(3E,5S,8S,10E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,10-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 132561077 |
| Molecular Formula | C24H39N5O6 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (2S)-2-[[(2S)-1-[[(3E,5S,8S,10E)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,10-dien-8-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)N[C@H](C(=O)N[C@H]1C/C=C/CNC(=O)/C=C/[C@H](C(C)C)NC1=O)C(C)C)C(=O)O |
| InChI | InChI=1S/C24H39N5O6/c1-13(2)16-10-11-18(30)25-12-8-7-9-17(21(31)26-16)27-22(32)19(14(3)4)28-24(35)29-20(15(5)6)23(33)34/h7-8,10-11,13-17,19-20H,9,12H2,1-6H3,(H,25,30)(H,26,31)(H,27,32)(H,33,34)(H2,28,29,35)/b8-7+,11-10+/t16-,17+,19+,20+/m1/s1 |
| InChIKey | CFRYMEAZTMDQML-PGKQEMIDSA-N |
| XLogP | 0.68 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|