C26H43N5O6 — CID 139585986
2-[[1-[[(3Z,9Z)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamoylamino]-3-methylpentanoic acid (PubChem CID 139585986) has the molecular formula C26H43N5O6 and a molecular weight of 521.66 g/mol. Its IUPAC name is 2-[[1-[[(3Z,9Z)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[[1-[[(3Z,9Z)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 139585986 |
| Molecular Formula | C26H43N5O6 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | 2-[[1-[[(3Z,9Z)-2,7-dioxo-5-propan-2-yl-1,6-diazacyclododeca-3,9-dien-8-yl]amino]-3-methyl-1-oxopentan-2-yl]carbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)NC(C(=O)NC1/C=C\CCNC(=O)/C=C\C(C(C)C)NC1=O)C(C)CC)C(=O)O |
| InChI | InChI=1S/C26H43N5O6/c1-7-16(5)21(30-26(37)31-22(25(35)36)17(6)8-2)24(34)29-19-11-9-10-14-27-20(32)13-12-18(15(3)4)28-23(19)33/h9,11-13,15-19,21-22H,7-8,10,14H2,1-6H3,(H,27,32)(H,28,33)(H,29,34)(H,35,36)(H2,30,31,37)/b11-9-,13-12- |
| InChIKey | BWXSLEKEHASZOI-KBMMCUQCSA-N |
| XLogP | 1.46 |
| TPSA | 165.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|