C17H26N4O5 — CID 161421775
1-[1-hydroxy-4-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-3-oxobutan-2-yl]-3-methylurea (PubChem CID 161421775) has the molecular formula C17H26N4O5 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[1-hydroxy-4-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-3-oxobutan-2-yl]-3-methylurea.
| Compound Name | 1-[1-hydroxy-4-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-3-oxobutan-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 161421775 |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 1-[1-hydroxy-4-[(3E,5S,8S,9E)-5-methyl-2,7-dioxo-1,6-diazacyclododeca-3,9-dien-8-yl]-3-oxobutan-2-yl]-3-methylurea |
| SMILES | CNC(=O)NC(CO)C(=O)C[C@H]1/C=C/CCNC(=O)/C=C/[C@H](C)NC1=O |
| InChI | InChI=1S/C17H26N4O5/c1-11-6-7-15(24)19-8-4-3-5-12(16(25)20-11)9-14(23)13(10-22)21-17(26)18-2/h3,5-7,11-13,22H,4,8-10H2,1-2H3,(H,19,24)(H,20,25)(H2,18,21,26)/b5-3+,7-6+/t11-,12+,13?/m0/s1 |
| InChIKey | FTNGPCJJBFQRRX-ROLLGDLYSA-N |
| XLogP | -1.01 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|