C16H26BrN3O4 — CID 122194226
tert-butyl N-[(2S)-1-(3-bromo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl)-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 122194226) has the molecular formula C16H26BrN3O4 and a molecular weight of 404.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-bromo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl)-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-bromo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl)-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 122194226 |
| Molecular Formula | C16H26BrN3O4 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-bromo-3a,4,6,6a-tetrahydropyrrolo[3,4-d][1,2]oxazol-5-yl)-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC2ON=C(Br)C2C1 |
| InChI | InChI=1S/C16H26BrN3O4/c1-9(2)6-11(18-15(22)23-16(3,4)5)14(21)20-7-10-12(8-20)24-19-13(10)17/h9-12H,6-8H2,1-5H3,(H,18,22)/t10?,11-,12?/m0/s1 |
| InChIKey | CCTJZICAYKLHNS-CXQJBGSLSA-N |
| XLogP | 2.49 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |