C34H59N5O6 — CID 122195051
(2S,4S,5S,7S)-5-amino-4-hydroxy-N-[3-[4-(2-hydroxyethyl)triazol-1-yl]-2,2-dimethylpropyl]-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide (PubChem CID 122195051) has the molecular formula C34H59N5O6 and a molecular weight of 633.88 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-amino-4-hydroxy-N-[3-[4-(2-hydroxyethyl)triazol-1-yl]-2,2-dimethylpropyl]-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide.
| Compound Name | (2S,4S,5S,7S)-5-amino-4-hydroxy-N-[3-[4-(2-hydroxyethyl)triazol-1-yl]-2,2-dimethylpropyl]-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 122195051 |
| Molecular Formula | C34H59N5O6 |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.45 |
| IUPAC Name | (2S,4S,5S,7S)-5-amino-4-hydroxy-N-[3-[4-(2-hydroxyethyl)triazol-1-yl]-2,2-dimethylpropyl]-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NCC(C)(C)Cn2cc(CCO)nn2)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C34H59N5O6/c1-23(2)26(16-25-10-11-31(44-8)32(17-25)45-15-9-14-43-7)18-29(35)30(41)19-28(24(3)4)33(42)36-21-34(5,6)22-39-20-27(12-13-40)37-38-39/h10-11,17,20,23-24,26,28-30,40-41H,9,12-16,18-19,21-22,35H2,1-8H3,(H,36,42)/t26-,28-,29-,30-/m0/s1 |
| InChIKey | PRXDOJCFLRALDE-SYKYGTKKSA-N |
| XLogP | 3.63 |
| TPSA | 153.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|