C18H14N2O5 — CID 122196462
8-hydroxy-2-[(3-methoxyphenyl)carbamoyl]quinoline-5-carboxylic acid (PubChem CID 122196462) has the molecular formula C18H14N2O5 and a molecular weight of 338.32 g/mol. Its IUPAC name is 8-hydroxy-2-[(3-methoxyphenyl)carbamoyl]quinoline-5-carboxylic acid.
| Compound Name | 8-hydroxy-2-[(3-methoxyphenyl)carbamoyl]quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 122196462 |
| Molecular Formula | C18H14N2O5 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 8-hydroxy-2-[(3-methoxyphenyl)carbamoyl]quinoline-5-carboxylic acid |
| SMILES | COc1cccc(NC(=O)c2ccc3c(C(=O)O)ccc(O)c3n2)c1 |
| InChI | InChI=1S/C18H14N2O5/c1-25-11-4-2-3-10(9-11)19-17(22)14-7-5-12-13(18(23)24)6-8-15(21)16(12)20-14/h2-9,21H,1H3,(H,19,22)(H,23,24) |
| InChIKey | KODBQNJBLYLCNQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |