About 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one
6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one (PubChem CID 122200231) has the molecular formula C11H6Cl3NO
and a molecular weight of 274.53 g/mol. Its IUPAC name is 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one |
| PubChem CID | 122200231 |
| Molecular Formula | C11H6Cl3NO |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one |
| SMILES | O=c1cccc(-c2cc(Cl)c(Cl)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C11H6Cl3NO/c12-7-4-6(5-8(13)11(7)14)9-2-1-3-10(16)15-9/h1-5H,(H,15,16) |
| InChIKey | YGXCGMMCWJTOQN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one?
The IUPAC name of 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one (CID 122200231) is 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one.
What is the SMILES notation for 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one?
The canonical SMILES for 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one is O=c1cccc(-c2cc(Cl)c(Cl)c(Cl)c2)[nH]1.
What is the InChIKey of 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one?
The InChIKey is YGXCGMMCWJTOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6Cl3NO/c12-7-4-6(5-8(13)11(7)14)9-2-1-3-10(16)15-9/h1-5H,(H,15,16).
What are the key properties of 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one?
6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one has a molecular weight of 274.53 g/mol, XLogP of 4.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4,5-trichlorophenyl)-1H-pyridin-2-one is sourced from PubChem (CID 122200231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).