C14H15ClN2O2 — CID 122201985
(1R,5R,7S)-7-(4-chlorophenyl)-5,6-dimethyl-3,6-diazabicyclo[3.2.1]octane-2,4-dione (PubChem CID 122201985) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is (1R,5R,7S)-7-(4-chlorophenyl)-5,6-dimethyl-3,6-diazabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1R,5R,7S)-7-(4-chlorophenyl)-5,6-dimethyl-3,6-diazabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 122201985 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (1R,5R,7S)-7-(4-chlorophenyl)-5,6-dimethyl-3,6-diazabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CN1[C@H](c2ccc(Cl)cc2)[C@H]2C[C@]1(C)C(=O)NC2=O |
| InChI | InChI=1S/C14H15ClN2O2/c1-14-7-10(12(18)16-13(14)19)11(17(14)2)8-3-5-9(15)6-4-8/h3-6,10-11H,7H2,1-2H3,(H,16,18,19)/t10-,11-,14-/m1/s1 |
| InChIKey | BRMUUWNRGPWXRM-JTNHKYCSSA-N |
| XLogP | 1.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|