C14H15ClN2O2 — CID 101415450
(5R,6R,7S)-7-(4-chlorophenyl)-5-methyl-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazole-6-carbaldehyde (PubChem CID 101415450) has the molecular formula C14H15ClN2O2 and a molecular weight of 278.74 g/mol. Its IUPAC name is (5R,6R,7S)-7-(4-chlorophenyl)-5-methyl-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazole-6-carbaldehyde.
| Compound Name | (5R,6R,7S)-7-(4-chlorophenyl)-5-methyl-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazole-6-carbaldehyde |
|---|---|
| PubChem CID | 101415450 |
| Molecular Formula | C14H15ClN2O2 |
| Molecular Weight | 278.74 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | (5R,6R,7S)-7-(4-chlorophenyl)-5-methyl-3-oxo-2,5,6,7-tetrahydro-1H-pyrazolo[1,2-a]pyrazole-6-carbaldehyde |
| SMILES | C[C@@H]1[C@@H](C=O)[C@@H](c2ccc(Cl)cc2)N2CCC(=O)N12 |
| InChI | InChI=1S/C14H15ClN2O2/c1-9-12(8-18)14(10-2-4-11(15)5-3-10)16-7-6-13(19)17(9)16/h2-5,8-9,12,14H,6-7H2,1H3/t9-,12-,14-/m1/s1 |
| InChIKey | CUKKTJMLZDWNIY-GAJTVXKRSA-N |
| XLogP | 2.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|