C17H12N2OSe — CID 122204061
5-methyl-2-quinolin-8-yl-1,2-benzoselenazol-3-one (PubChem CID 122204061) has the molecular formula C17H12N2OSe and a molecular weight of 339.26 g/mol. Its IUPAC name is 5-methyl-2-quinolin-8-yl-1,2-benzoselenazol-3-one.
| Compound Name | 5-methyl-2-quinolin-8-yl-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 122204061 |
| Molecular Formula | C17H12N2OSe |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 5-methyl-2-quinolin-8-yl-1,2-benzoselenazol-3-one |
| SMILES | Cc1ccc2[se]n(-c3cccc4cccnc34)c(=O)c2c1 |
| InChI | InChI=1S/C17H12N2OSe/c1-11-7-8-15-13(10-11)17(20)19(21-15)14-6-2-4-12-5-3-9-18-16(12)14/h2-10H,1H3 |
| InChIKey | DJZOFSFBOWNBBT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|