C12H8N2O2Se — CID 13277178
2-(3-hydroxy-2-pyridinyl)-1,2-benzoselenazol-3-one (PubChem CID 13277178) has the molecular formula C12H8N2O2Se and a molecular weight of 291.17 g/mol. Its IUPAC name is 2-(3-hydroxy-2-pyridinyl)-1,2-benzoselenazol-3-one.
| Compound Name | 2-(3-hydroxy-2-pyridinyl)-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 13277178 |
| Molecular Formula | C12H8N2O2Se |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-(3-hydroxy-2-pyridinyl)-1,2-benzoselenazol-3-one |
| SMILES | O=c1c2ccccc2[se]n1-c1ncccc1O |
| InChI | InChI=1S/C12H8N2O2Se/c15-9-5-3-7-13-11(9)14-12(16)8-4-1-2-6-10(8)17-14/h1-7,15H |
| InChIKey | BYDOTJMKOMWDQU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|