C26H26N4O2 — CID 122205051
9H-fluoren-9-ylmethyl N-(1-phenyldiazenylpiperidin-4-yl)carbamate (PubChem CID 122205051) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-(1-phenyldiazenylpiperidin-4-yl)carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-(1-phenyldiazenylpiperidin-4-yl)carbamate |
|---|---|
| PubChem CID | 122205051 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-(1-phenyldiazenylpiperidin-4-yl)carbamate |
| SMILES | O=C(NC1CCN(/N=N/c2ccccc2)CC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H26N4O2/c31-26(27-19-14-16-30(17-15-19)29-28-20-8-2-1-3-9-20)32-18-25-23-12-6-4-10-21(23)22-11-5-7-13-24(22)25/h1-13,19,25H,14-18H2,(H,27,31)/b29-28+ |
| InChIKey | PRCJEHSBNMXDLW-ZQHSETAFSA-N |
| XLogP | 5.69 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|