C26H25N3O4 — CID 131423946
6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]pyridine-3-carboxylic acid (PubChem CID 131423946) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 131423946 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 6-[4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidin-1-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(NC1CCN(c2ccc(C(=O)O)cn2)CC1)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H25N3O4/c30-25(31)17-9-10-24(27-15-17)29-13-11-18(12-14-29)28-26(32)33-16-23-21-7-3-1-5-19(21)20-6-2-4-8-22(20)23/h1-10,15,18,23H,11-14,16H2,(H,28,32)(H,30,31) |
| InChIKey | CWUQJGOXNPUAFC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |