C31H34N4O6 — CID 175464467
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(6-morpholin-4-ylpyridine-3-carbonyl)amino]hexanoic acid (PubChem CID 175464467) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(6-morpholin-4-ylpyridine-3-carbonyl)amino]hexanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(6-morpholin-4-ylpyridine-3-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 175464467 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(6-morpholin-4-ylpyridine-3-carbonyl)amino]hexanoic acid |
| SMILES | O=C(NC(CCCCNC(=O)c1ccc(N2CCOCC2)nc1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C31H34N4O6/c36-29(21-12-13-28(33-19-21)35-15-17-40-18-16-35)32-14-6-5-11-27(30(37)38)34-31(39)41-20-26-24-9-3-1-7-22(24)23-8-2-4-10-25(23)26/h1-4,7-10,12-13,19,26-27H,5-6,11,14-18,20H2,(H,32,36)(H,34,39)(H,37,38) |
| InChIKey | OOLZVHOCWATCPA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|