C19H33O3P — CID 122205509
6-[(1E,4E)-5-diethoxyphosphoryl-3-methylpenta-1,4-dienyl]-1,5,5-trimethylcyclohexene (PubChem CID 122205509) has the molecular formula C19H33O3P and a molecular weight of 340.44 g/mol. Its IUPAC name is 6-[(1E,4E)-5-diethoxyphosphoryl-3-methylpenta-1,4-dienyl]-1,5,5-trimethylcyclohexene.
| Compound Name | 6-[(1E,4E)-5-diethoxyphosphoryl-3-methylpenta-1,4-dienyl]-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 122205509 |
| Molecular Formula | C19H33O3P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 6-[(1E,4E)-5-diethoxyphosphoryl-3-methylpenta-1,4-dienyl]-1,5,5-trimethylcyclohexene |
| SMILES | CCOP(=O)(/C=C/C(C)/C=C/C1C(C)=CCCC1(C)C)OCC |
| InChI | InChI=1S/C19H33O3P/c1-7-21-23(20,22-8-2)15-13-16(3)11-12-18-17(4)10-9-14-19(18,5)6/h10-13,15-16,18H,7-9,14H2,1-6H3/b12-11+,15-13+ |
| InChIKey | WPXZNZFSXGOOKA-NOVYJZLUSA-N |
| XLogP | 6.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|