C19H33O3P — CID 11046086
2-[(1E,3E)-5-diethoxyphosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene (PubChem CID 11046086) has the molecular formula C19H33O3P and a molecular weight of 340.44 g/mol. Its IUPAC name is 2-[(1E,3E)-5-diethoxyphosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E)-5-diethoxyphosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 11046086 |
| Molecular Formula | C19H33O3P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-[(1E,3E)-5-diethoxyphosphoryl-3-methylpenta-1,3-dienyl]-1,3,3-trimethylcyclohexene |
| SMILES | CCOP(=O)(C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)OCC |
| InChI | InChI=1S/C19H33O3P/c1-7-21-23(20,22-8-2)15-13-16(3)11-12-18-17(4)10-9-14-19(18,5)6/h11-13H,7-10,14-15H2,1-6H3/b12-11+,16-13+ |
| InChIKey | OXWMYIHZAKKTKJ-VUWKKMCJSA-N |
| XLogP | 6.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|