C17H33O3P — CID 102017535
(E,7E)-7-(diethoxyphosphorylmethylidene)dodec-5-ene (PubChem CID 102017535) has the molecular formula C17H33O3P and a molecular weight of 316.42 g/mol. Its IUPAC name is (E,7E)-7-(diethoxyphosphorylmethylidene)dodec-5-ene.
| Compound Name | (E,7E)-7-(diethoxyphosphorylmethylidene)dodec-5-ene |
|---|---|
| PubChem CID | 102017535 |
| Molecular Formula | C17H33O3P |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (E,7E)-7-(diethoxyphosphorylmethylidene)dodec-5-ene |
| SMILES | CCCC/C=C/C(=C/P(=O)(OCC)OCC)CCCCC |
| InChI | InChI=1S/C17H33O3P/c1-5-9-11-13-15-17(14-12-10-6-2)16-21(18,19-7-3)20-8-4/h13,15-16H,5-12,14H2,1-4H3/b15-13+,17-16+ |
| InChIKey | NAJIJDPEFFHUGW-TZSXFDEBSA-N |
| XLogP | 6.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|