C18H35O3P — CID 102017536
(E,8E)-8-(diethoxyphosphorylmethylidene)tridec-6-ene (PubChem CID 102017536) has the molecular formula C18H35O3P and a molecular weight of 330.45 g/mol. Its IUPAC name is (E,8E)-8-(diethoxyphosphorylmethylidene)tridec-6-ene.
| Compound Name | (E,8E)-8-(diethoxyphosphorylmethylidene)tridec-6-ene |
|---|---|
| PubChem CID | 102017536 |
| Molecular Formula | C18H35O3P |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (E,8E)-8-(diethoxyphosphorylmethylidene)tridec-6-ene |
| SMILES | CCCCC/C=C/C(=C/P(=O)(OCC)OCC)CCCCC |
| InChI | InChI=1S/C18H35O3P/c1-5-9-11-12-14-16-18(15-13-10-6-2)17-22(19,20-7-3)21-8-4/h14,16-17H,5-13,15H2,1-4H3/b16-14+,18-17+ |
| InChIKey | RGKMAFKAUHNMIE-ZCXPIULRSA-N |
| XLogP | 6.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|