C13H17FO2 — CID 122208201
1-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pentan-1-ol (PubChem CID 122208201) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pentan-1-ol.
| Compound Name | 1-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 122208201 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-[(2S,3S)-3-(4-fluorophenyl)oxiran-2-yl]pentan-1-ol |
| SMILES | CCCCC(O)[C@@H]1O[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H17FO2/c1-2-3-4-11(15)13-12(16-13)9-5-7-10(14)8-6-9/h5-8,11-13,15H,2-4H2,1H3/t11?,12-,13-/m0/s1 |
| InChIKey | KDPVDEMKDVVTLX-SPOOISQMSA-N |
| XLogP | 2.82 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|