C23H28O6 — CID 122209401
2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzoate (PubChem CID 122209401) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 122209401 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 4-[(3,5-dimethyl-4-oxocyclohexa-2,5-dien-1-ylidene)methyl]benzoate |
| SMILES | COCCOCCOCCOC(=O)c1ccc(C=C2C=C(C)C(=O)C(C)=C2)cc1 |
| InChI | InChI=1S/C23H28O6/c1-17-14-20(15-18(2)22(17)24)16-19-4-6-21(7-5-19)23(25)29-13-12-28-11-10-27-9-8-26-3/h4-7,14-16H,8-13H2,1-3H3 |
| InChIKey | YJEQDASKPSTVTK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|