C15H26O2 — CID 122211308
(1R,2R,3S,6S,7S,8S)-2-(hydroxymethyl)-2,6,8-trimethyltricyclo[5.3.1.03,8]undecan-3-ol (PubChem CID 122211308) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (1R,2R,3S,6S,7S,8S)-2-(hydroxymethyl)-2,6,8-trimethyltricyclo[5.3.1.03,8]undecan-3-ol.
| Compound Name | (1R,2R,3S,6S,7S,8S)-2-(hydroxymethyl)-2,6,8-trimethyltricyclo[5.3.1.03,8]undecan-3-ol |
|---|---|
| PubChem CID | 122211308 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (1R,2R,3S,6S,7S,8S)-2-(hydroxymethyl)-2,6,8-trimethyltricyclo[5.3.1.03,8]undecan-3-ol |
| SMILES | C[C@H]1CC[C@@]2(O)[C@@](C)(CO)[C@@H]3CC[C@@]2(C)[C@H]1C3 |
| InChI | InChI=1S/C15H26O2/c1-10-4-7-15(17)13(2)6-5-11(8-12(10)13)14(15,3)9-16/h10-12,16-17H,4-9H2,1-3H3/t10-,11+,12-,13-,14-,15-/m0/s1 |
| InChIKey | XSEXCOHUPLPNCB-IWTMDLJTSA-N |
| XLogP | 2.58 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |