C18H32O — CID 98137939
(1S,2S,4R,5R)-4,5-dimethyl-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol (PubChem CID 98137939) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is (1S,2S,4R,5R)-4,5-dimethyl-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol.
| Compound Name | (1S,2S,4R,5R)-4,5-dimethyl-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 98137939 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | (1S,2S,4R,5R)-4,5-dimethyl-2-[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]cyclohexan-1-ol |
| SMILES | C[C@@H]1C[C@@H]([C@H]2C[C@H]3CC[C@@]2(C)C3(C)C)[C@@H](O)C[C@H]1C |
| InChI | InChI=1S/C18H32O/c1-11-8-14(16(19)9-12(11)2)15-10-13-6-7-18(15,5)17(13,3)4/h11-16,19H,6-10H2,1-5H3/t11-,12-,13-,14+,15-,16+,18-/m1/s1 |
| InChIKey | UNCFQTHQEXAQIY-MIJZHBPMSA-N |
| XLogP | 4.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |