C33H25NO3 — CID 122212997
4-benzoyl-3,5-diphenyl-1'-prop-2-enylspiro[3H-furan-2,3'-indole]-2'-one (PubChem CID 122212997) has the molecular formula C33H25NO3 and a molecular weight of 483.57 g/mol. Its IUPAC name is 4-benzoyl-3,5-diphenyl-1'-prop-2-enylspiro[3H-furan-2,3'-indole]-2'-one.
| Compound Name | 4-benzoyl-3,5-diphenyl-1'-prop-2-enylspiro[3H-furan-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 122212997 |
| Molecular Formula | C33H25NO3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-benzoyl-3,5-diphenyl-1'-prop-2-enylspiro[3H-furan-2,3'-indole]-2'-one |
| SMILES | C=CCN1C(=O)C2(OC(c3ccccc3)=C(C(=O)c3ccccc3)C2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C33H25NO3/c1-2-22-34-27-21-13-12-20-26(27)33(32(34)36)29(23-14-6-3-7-15-23)28(30(35)24-16-8-4-9-17-24)31(37-33)25-18-10-5-11-19-25/h2-21,29H,1,22H2 |
| InChIKey | CWLAZJPJPVHDJA-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|