C17H26O5 — CID 122214430
dimethyl 2-(3-methylbut-3-enyl)-6-prop-1-en-2-yloxane-3,3-dicarboxylate (PubChem CID 122214430) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is dimethyl 2-(3-methylbut-3-enyl)-6-prop-1-en-2-yloxane-3,3-dicarboxylate.
| Compound Name | dimethyl 2-(3-methylbut-3-enyl)-6-prop-1-en-2-yloxane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 122214430 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | dimethyl 2-(3-methylbut-3-enyl)-6-prop-1-en-2-yloxane-3,3-dicarboxylate |
| SMILES | C=C(C)CCC1OC(C(=C)C)CCC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C17H26O5/c1-11(2)7-8-14-17(15(18)20-5,16(19)21-6)10-9-13(22-14)12(3)4/h13-14H,1,3,7-10H2,2,4-6H3 |
| InChIKey | CNUAUPLSHMIOQC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|