About 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate
2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate (PubChem CID 122215971) has the molecular formula C15H25NO3Si
and a molecular weight of 295.45 g/mol. Its IUPAC name is 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate.
Molecular Properties
| Compound Name | 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate |
| PubChem CID | 122215971 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate |
| SMILES | CC(C)(Nc1ccccc1)C(=O)OCCO[Si](C)(C)C |
| InChI | InChI=1S/C15H25NO3Si/c1-15(2,16-13-9-7-6-8-10-13)14(17)18-11-12-19-20(3,4)5/h6-10,16H,11-12H2,1-5H3 |
| InChIKey | YTRFMHHETVJCDA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate?
The IUPAC name of 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate (CID 122215971) is 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate.
What is the SMILES notation for 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate?
The canonical SMILES for 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate is CC(C)(Nc1ccccc1)C(=O)OCCO[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate?
The InChIKey is YTRFMHHETVJCDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25NO3Si/c1-15(2,16-13-9-7-6-8-10-13)14(17)18-11-12-19-20(3,4)5/h6-10,16H,11-12H2,1-5H3.
What are the key properties of 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate?
2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate has a molecular weight of 295.45 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilyloxyethyl 2-anilino-2-methylpropanoate is sourced from PubChem (CID 122215971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).