C29H58O6Si2 — CID 122217965
ethyl (7S)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,5-dioxotetradecanoate (PubChem CID 122217965) has the molecular formula C29H58O6Si2 and a molecular weight of 558.95 g/mol. Its IUPAC name is ethyl (7S)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,5-dioxotetradecanoate.
| Compound Name | ethyl (7S)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,5-dioxotetradecanoate |
|---|---|
| PubChem CID | 122217965 |
| Molecular Formula | C29H58O6Si2 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | ethyl (7S)-7,14-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methyl-3,5-dioxotetradecanoate |
| SMILES | CCOC(=O)C(C)C(=O)CC(=O)C[C@H](CCCCCCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H58O6Si2/c1-13-33-27(32)23(2)26(31)22-24(30)21-25(35-37(11,12)29(6,7)8)19-17-15-14-16-18-20-34-36(9,10)28(3,4)5/h23,25H,13-22H2,1-12H3/t23?,25-/m0/s1 |
| InChIKey | CPGVHEJVGWWGRE-YNMFNDETSA-N |
| XLogP | 7.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|