C10H19NO5 — CID 122218120
(1R,2R,3S,5R,6R,7S,8R)-3,7-bis(hydroxymethyl)-5-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol (PubChem CID 122218120) has the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. Its IUPAC name is (1R,2R,3S,5R,6R,7S,8R)-3,7-bis(hydroxymethyl)-5-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol.
| Compound Name | (1R,2R,3S,5R,6R,7S,8R)-3,7-bis(hydroxymethyl)-5-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol |
|---|---|
| PubChem CID | 122218120 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (1R,2R,3S,5R,6R,7S,8R)-3,7-bis(hydroxymethyl)-5-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,6-triol |
| SMILES | C[C@@H]1[C@H](O)[C@H](CO)[C@@H]2[C@@H](O)[C@H](O)[C@H](CO)N21 |
| InChI | InChI=1S/C10H19NO5/c1-4-8(14)5(2-12)7-10(16)9(15)6(3-13)11(4)7/h4-10,12-16H,2-3H2,1H3/t4-,5-,6+,7-,8+,9-,10-/m1/s1 |
| InChIKey | WZWWCYHKAUCYID-KPOOTMIGSA-N |
| XLogP | -2.88 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |