C11H10Cl2INO — CID 122218264
7-chloro-3-(chloromethyl)-5-iodo-1,3-dimethylindol-2-one (PubChem CID 122218264) has the molecular formula C11H10Cl2INO and a molecular weight of 370.02 g/mol. Its IUPAC name is 7-chloro-3-(chloromethyl)-5-iodo-1,3-dimethylindol-2-one.
| Compound Name | 7-chloro-3-(chloromethyl)-5-iodo-1,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 122218264 |
| Molecular Formula | C11H10Cl2INO |
| Molecular Weight | 370.02 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | 7-chloro-3-(chloromethyl)-5-iodo-1,3-dimethylindol-2-one |
| SMILES | CN1C(=O)C(C)(CCl)c2cc(I)cc(Cl)c21 |
| InChI | InChI=1S/C11H10Cl2INO/c1-11(5-12)7-3-6(14)4-8(13)9(7)15(2)10(11)16/h3-4H,5H2,1-2H3 |
| InChIKey | YRPQLXRJQWJNQH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.02 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|