C13H24O3Si — CID 122219555
(5S)-5-[(E,1R)-1-hydroxy-3-triethylsilylprop-2-enyl]oxolan-2-one (PubChem CID 122219555) has the molecular formula C13H24O3Si and a molecular weight of 256.42 g/mol. Its IUPAC name is (5S)-5-[(E,1R)-1-hydroxy-3-triethylsilylprop-2-enyl]oxolan-2-one.
| Compound Name | (5S)-5-[(E,1R)-1-hydroxy-3-triethylsilylprop-2-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 122219555 |
| Molecular Formula | C13H24O3Si |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (5S)-5-[(E,1R)-1-hydroxy-3-triethylsilylprop-2-enyl]oxolan-2-one |
| SMILES | CC[Si](/C=C/[C@@H](O)[C@@H]1CCC(=O)O1)(CC)CC |
| InChI | InChI=1S/C13H24O3Si/c1-4-17(5-2,6-3)10-9-11(14)12-7-8-13(15)16-12/h9-12,14H,4-8H2,1-3H3/b10-9+/t11-,12+/m1/s1 |
| InChIKey | DMVDVQBIFGKTMA-ZGFRAZBVSA-N |
| XLogP | 2.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|