C21H28O5 — CID 122221348
(3aR,7S,9aS)-7-hydroxy-1-[6-(hydroxymethyl)-5-oxohept-6-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one (PubChem CID 122221348) has the molecular formula C21H28O5 and a molecular weight of 360.40 g/mol. Its IUPAC name is (3aR,7S,9aS)-7-hydroxy-1-[6-(hydroxymethyl)-5-oxohept-6-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one.
| Compound Name | (3aR,7S,9aS)-7-hydroxy-1-[6-(hydroxymethyl)-5-oxohept-6-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
|---|---|
| PubChem CID | 122221348 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | (3aR,7S,9aS)-7-hydroxy-1-[6-(hydroxymethyl)-5-oxohept-6-en-2-yl]-3a-methyl-3,5,6,7,9,9a-hexahydrocyclopenta[b]chromen-8-one |
| SMILES | CC(CCC(=O)C(=C)CO)C1=CC[C@@]2([C@H]1CC3=C(O2)CC[C@@H](C3=O)O)C |
| InChI | InChI=1S/C21H28O5/c1-12(4-5-17(23)13(2)11-22)14-8-9-21(3)16(14)10-15-19(26-21)7-6-18(24)20(15)25/h8,12,16,18,22,24H,2,4-7,9-11H2,1,3H3/t12?,16-,18-,21+/m0/s1 |
| InChIKey | AUMFYIVCRMIHNZ-SDXJXCEMSA-N |
| XLogP | 1.10 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 701 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|