C16H24O4 — CID 46883379
(6S,7R)-6,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-5,6,7,8-tetrahydro-3H-chromen-4-one (PubChem CID 46883379) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (6S,7R)-6,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-5,6,7,8-tetrahydro-3H-chromen-4-one.
| Compound Name | (6S,7R)-6,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-5,6,7,8-tetrahydro-3H-chromen-4-one |
|---|---|
| PubChem CID | 46883379 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (6S,7R)-6,7-dihydroxy-2,2-dimethyl-8-(3-methylbut-2-enyl)-5,6,7,8-tetrahydro-3H-chromen-4-one |
| SMILES | CC(C)=CCC1C2=C(C[C@H](O)[C@@H]1O)C(=O)CC(C)(C)O2 |
| InChI | InChI=1S/C16H24O4/c1-9(2)5-6-10-14(19)12(17)7-11-13(18)8-16(3,4)20-15(10)11/h5,10,12,14,17,19H,6-8H2,1-4H3/t10?,12-,14+/m0/s1 |
| InChIKey | CUINTIYPFNXGBV-BNPZDMCGSA-N |
| XLogP | 2.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|