C26H30N2O3S — CID 122221723
3-(benzenesulfonyl)-4,4-bis[4-(dimethylamino)phenyl]butan-2-one (PubChem CID 122221723) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-4,4-bis[4-(dimethylamino)phenyl]butan-2-one.
| Compound Name | 3-(benzenesulfonyl)-4,4-bis[4-(dimethylamino)phenyl]butan-2-one |
|---|---|
| PubChem CID | 122221723 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 3-(benzenesulfonyl)-4,4-bis[4-(dimethylamino)phenyl]butan-2-one |
| SMILES | CC(=O)C(C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O3S/c1-19(29)26(32(30,31)24-9-7-6-8-10-24)25(20-11-15-22(16-12-20)27(2)3)21-13-17-23(18-14-21)28(4)5/h6-18,25-26H,1-5H3 |
| InChIKey | WLJDZELGDOUXLH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|