C28H32N2O — CID 102265564
(E,2R)-2-[bis[4-(dimethylamino)phenyl]methyl]-4-phenylpent-3-enal (PubChem CID 102265564) has the molecular formula C28H32N2O and a molecular weight of 412.58 g/mol. Its IUPAC name is (E,2R)-2-[bis[4-(dimethylamino)phenyl]methyl]-4-phenylpent-3-enal.
| Compound Name | (E,2R)-2-[bis[4-(dimethylamino)phenyl]methyl]-4-phenylpent-3-enal |
|---|---|
| PubChem CID | 102265564 |
| Molecular Formula | C28H32N2O |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (E,2R)-2-[bis[4-(dimethylamino)phenyl]methyl]-4-phenylpent-3-enal |
| SMILES | C/C(=C\[C@@H](C=O)C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O/c1-21(22-9-7-6-8-10-22)19-25(20-31)28(23-11-15-26(16-12-23)29(2)3)24-13-17-27(18-14-24)30(4)5/h6-20,25,28H,1-5H3/b21-19+/t25-/m0/s1 |
| InChIKey | FRVMAPVKJXIZAU-NFRPBIJRSA-N |
| XLogP | 5.87 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|