C19H26N2O4S2 — CID 9159185
N-[(2R)-2-(benzenesulfonyl)-2-[4-(dimethylamino)phenyl]ethyl]propane-1-sulfonamide (PubChem CID 9159185) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is N-[(2R)-2-(benzenesulfonyl)-2-[4-(dimethylamino)phenyl]ethyl]propane-1-sulfonamide.
| Compound Name | N-[(2R)-2-(benzenesulfonyl)-2-[4-(dimethylamino)phenyl]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 9159185 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[(2R)-2-(benzenesulfonyl)-2-[4-(dimethylamino)phenyl]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC[C@@H](c1ccc(N(C)C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O4S2/c1-4-14-26(22,23)20-15-19(16-10-12-17(13-11-16)21(2)3)27(24,25)18-8-6-5-7-9-18/h5-13,19-20H,4,14-15H2,1-3H3/t19-/m0/s1 |
| InChIKey | RCMQSKFPKSAIFM-IBGZPJMESA-N |
| XLogP | 2.60 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|