C17H20ClNO4S2 — CID 9184485
N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-chloropropane-1-sulfonamide (PubChem CID 9184485) has the molecular formula C17H20ClNO4S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-chloropropane-1-sulfonamide.
| Compound Name | N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-chloropropane-1-sulfonamide |
|---|---|
| PubChem CID | 9184485 |
| Molecular Formula | C17H20ClNO4S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[(2R)-2-(benzenesulfonyl)-2-phenylethyl]-3-chloropropane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCl)NC[C@@H](c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20ClNO4S2/c18-12-7-13-24(20,21)19-14-17(15-8-3-1-4-9-15)25(22,23)16-10-5-2-6-11-16/h1-6,8-11,17,19H,7,12-14H2/t17-/m0/s1 |
| InChIKey | XPLSKIYTGXJISK-KRWDZBQOSA-N |
| XLogP | 2.75 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|