C9H7Br2ClO4S — CID 122221933
(5,7-dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methyl 2-chloroacetate (PubChem CID 122221933) has the molecular formula C9H7Br2ClO4S and a molecular weight of 406.48 g/mol. Its IUPAC name is (5,7-dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methyl 2-chloroacetate.
| Compound Name | (5,7-dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methyl 2-chloroacetate |
|---|---|
| PubChem CID | 122221933 |
| Molecular Formula | C9H7Br2ClO4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 403.81 |
| IUPAC Name | (5,7-dibromo-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methyl 2-chloroacetate |
| SMILES | O=C(CCl)OCC1COc2c(Br)sc(Br)c2O1 |
| InChI | InChI=1S/C9H7Br2ClO4S/c10-8-6-7(9(11)17-8)16-4(3-15-6)2-14-5(13)1-12/h4H,1-3H2 |
| InChIKey | CDODXIQYUKSSNW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|