C18H15ClN2O2 — CID 122222202
methyl 2-[(7-chloro-3-phenylisoquinolin-1-yl)amino]acetate (PubChem CID 122222202) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is methyl 2-[(7-chloro-3-phenylisoquinolin-1-yl)amino]acetate.
| Compound Name | methyl 2-[(7-chloro-3-phenylisoquinolin-1-yl)amino]acetate |
|---|---|
| PubChem CID | 122222202 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | methyl 2-[(7-chloro-3-phenylisoquinolin-1-yl)amino]acetate |
| SMILES | COC(=O)CNc1nc(-c2ccccc2)cc2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H15ClN2O2/c1-23-17(22)11-20-18-15-10-14(19)8-7-13(15)9-16(21-18)12-5-3-2-4-6-12/h2-10H,11H2,1H3,(H,20,21) |
| InChIKey | DDFUPMOFGHVDBR-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |