C8H4F4N2 — CID 122222869
4,5,6,7-tetrafluoro-1-methylbenzimidazole (PubChem CID 122222869) has the molecular formula C8H4F4N2 and a molecular weight of 204.13 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-1-methylbenzimidazole.
| Compound Name | 4,5,6,7-tetrafluoro-1-methylbenzimidazole |
|---|---|
| PubChem CID | 122222869 |
| Molecular Formula | C8H4F4N2 |
| Molecular Weight | 204.13 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 4,5,6,7-tetrafluoro-1-methylbenzimidazole |
| SMILES | Cn1cnc2c(F)c(F)c(F)c(F)c21 |
| InChI | InChI=1S/C8H4F4N2/c1-14-2-13-7-5(11)3(9)4(10)6(12)8(7)14/h2H,1H3 |
| InChIKey | OGQLTIZMEHMDMV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|