C10H8F2N2 — CID 147522970
5-ethenyl-6,7-difluoro-1-methylbenzimidazole (PubChem CID 147522970) has the molecular formula C10H8F2N2 and a molecular weight of 194.18 g/mol. Its IUPAC name is 5-ethenyl-6,7-difluoro-1-methylbenzimidazole.
| Compound Name | 5-ethenyl-6,7-difluoro-1-methylbenzimidazole |
|---|---|
| PubChem CID | 147522970 |
| Molecular Formula | C10H8F2N2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 5-ethenyl-6,7-difluoro-1-methylbenzimidazole |
| SMILES | C=Cc1cc2ncn(C)c2c(F)c1F |
| InChI | InChI=1S/C10H8F2N2/c1-3-6-4-7-10(9(12)8(6)11)14(2)5-13-7/h3-5H,1H2,2H3 |
| InChIKey | FLNITVFHVJOLPZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |