C9H9N3 — CID 178059890
5-ethenyl-3-methylimidazo[4,5-b]pyridine (PubChem CID 178059890) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 5-ethenyl-3-methylimidazo[4,5-b]pyridine.
| Compound Name | 5-ethenyl-3-methylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 178059890 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 5-ethenyl-3-methylimidazo[4,5-b]pyridine |
| SMILES | C=Cc1ccc2ncn(C)c2n1 |
| InChI | InChI=1S/C9H9N3/c1-3-7-4-5-8-9(11-7)12(2)6-10-8/h3-6H,1H2,2H3 |
| InChIKey | IKCCAIOKBBRZEU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |