C21H22BrN3 — CID 122223638
2-(benzenecarboximidoyl)-7-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine (PubChem CID 122223638) has the molecular formula C21H22BrN3 and a molecular weight of 396.33 g/mol. Its IUPAC name is 2-(benzenecarboximidoyl)-7-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine.
| Compound Name | 2-(benzenecarboximidoyl)-7-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine |
|---|---|
| PubChem CID | 122223638 |
| Molecular Formula | C21H22BrN3 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-(benzenecarboximidoyl)-7-bromo-1-N,1-N,8-N,8-N-tetramethylnaphthalene-1,8-diamine |
| SMILES | [H]/N=C(\c1ccccc1)c1ccc2ccc(Br)c(N(C)C)c2c1N(C)C |
| InChI | InChI=1S/C21H22BrN3/c1-24(2)20-16(19(23)15-8-6-5-7-9-15)12-10-14-11-13-17(22)21(18(14)20)25(3)4/h5-13,23H,1-4H3/b23-19+ |
| InChIKey | SLQSBPRJTKXRFP-FCDQGJHFSA-N |
| XLogP | 5.15 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|