C14H20O3 — CID 122224614
methyl 5,5-dimethyl-2-(2-methylprop-1-enyl)-6-oxocyclohexene-1-carboxylate (PubChem CID 122224614) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is methyl 5,5-dimethyl-2-(2-methylprop-1-enyl)-6-oxocyclohexene-1-carboxylate.
| Compound Name | methyl 5,5-dimethyl-2-(2-methylprop-1-enyl)-6-oxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 122224614 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | methyl 5,5-dimethyl-2-(2-methylprop-1-enyl)-6-oxocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(C=C(C)C)CCC(C)(C)C1=O |
| InChI | InChI=1S/C14H20O3/c1-9(2)8-10-6-7-14(3,4)12(15)11(10)13(16)17-5/h8H,6-7H2,1-5H3 |
| InChIKey | KMVIVYRTMNCSOD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|