C24H25NO2 — CID 122225002
(2R,3R,4S)-3-(2,2-dimethylpropanoyl)-4-ethenyl-2,4-diphenyloxolane-3-carbonitrile (PubChem CID 122225002) has the molecular formula C24H25NO2 and a molecular weight of 359.47 g/mol. Its IUPAC name is (2R,3R,4S)-3-(2,2-dimethylpropanoyl)-4-ethenyl-2,4-diphenyloxolane-3-carbonitrile.
| Compound Name | (2R,3R,4S)-3-(2,2-dimethylpropanoyl)-4-ethenyl-2,4-diphenyloxolane-3-carbonitrile |
|---|---|
| PubChem CID | 122225002 |
| Molecular Formula | C24H25NO2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (2R,3R,4S)-3-(2,2-dimethylpropanoyl)-4-ethenyl-2,4-diphenyloxolane-3-carbonitrile |
| SMILES | C=C[C@@]1(c2ccccc2)CO[C@H](c2ccccc2)[C@@]1(C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C24H25NO2/c1-5-23(19-14-10-7-11-15-19)17-27-20(18-12-8-6-9-13-18)24(23,16-25)21(26)22(2,3)4/h5-15,20H,1,17H2,2-4H3/t20-,23+,24+/m1/s1 |
| InChIKey | VBATZMCGOZHRRQ-QDSKXPNFSA-N |
| XLogP | 5.01 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|