C24H15NO3 — CID 122226298
16-(4-acetylphenyl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,14-dione (PubChem CID 122226298) has the molecular formula C24H15NO3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 16-(4-acetylphenyl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,14-dione.
| Compound Name | 16-(4-acetylphenyl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,14-dione |
|---|---|
| PubChem CID | 122226298 |
| Molecular Formula | C24H15NO3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 16-(4-acetylphenyl)-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,14-dione |
| SMILES | CC(=O)c1ccc(-c2[nH]c(=O)c3cccc4c3c2-c2ccccc2C4=O)cc1 |
| InChI | InChI=1S/C24H15NO3/c1-13(26)14-9-11-15(12-10-14)22-21-16-5-2-3-6-17(16)23(27)18-7-4-8-19(20(18)21)24(28)25-22/h2-12H,1H3,(H,25,28) |
| InChIKey | ZLZSYKXVZLBDRI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |