C27H23NO5 — CID 175436153
4-[3-(4-carboxyphenyl)-1-oxo-2H-isoquinolin-4-yl]-2,3-diethylbenzoic acid (PubChem CID 175436153) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is 4-[3-(4-carboxyphenyl)-1-oxo-2H-isoquinolin-4-yl]-2,3-diethylbenzoic acid.
| Compound Name | 4-[3-(4-carboxyphenyl)-1-oxo-2H-isoquinolin-4-yl]-2,3-diethylbenzoic acid |
|---|---|
| PubChem CID | 175436153 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-[3-(4-carboxyphenyl)-1-oxo-2H-isoquinolin-4-yl]-2,3-diethylbenzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(-c2c(-c3ccc(C(=O)O)cc3)[nH]c(=O)c3ccccc23)c1CC |
| InChI | InChI=1S/C27H23NO5/c1-3-17-18(4-2)22(27(32)33)14-13-20(17)23-19-7-5-6-8-21(19)25(29)28-24(23)15-9-11-16(12-10-15)26(30)31/h5-14H,3-4H2,1-2H3,(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | DGFBISCYQNUTCM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |