C17H20ClNO3 — CID 122227063
methyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 122227063) has the molecular formula C17H20ClNO3 and a molecular weight of 321.80 g/mol. Its IUPAC name is methyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | methyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 122227063 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | methyl (5E,7S,8R)-1-benzyl-8-chloro-9-oxo-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | COC(=O)[C@@H]1/C=C/CCCN(Cc2ccccc2)C(=O)[C@@H]1Cl |
| InChI | InChI=1S/C17H20ClNO3/c1-22-17(21)14-10-6-3-7-11-19(16(20)15(14)18)12-13-8-4-2-5-9-13/h2,4-6,8-10,14-15H,3,7,11-12H2,1H3/b10-6+/t14-,15-/m1/s1 |
| InChIKey | ZWBQYEGVFGKYRT-ILJFBXALSA-N |
| XLogP | 2.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|