C15H18ClNO — CID 10989127
(5E,8R)-1-benzyl-8-chloro-3,4,7,8-tetrahydro-2H-azonin-9-one (PubChem CID 10989127) has the molecular formula C15H18ClNO and a molecular weight of 263.77 g/mol. Its IUPAC name is (5E,8R)-1-benzyl-8-chloro-3,4,7,8-tetrahydro-2H-azonin-9-one.
| Compound Name | (5E,8R)-1-benzyl-8-chloro-3,4,7,8-tetrahydro-2H-azonin-9-one |
|---|---|
| PubChem CID | 10989127 |
| Molecular Formula | C15H18ClNO |
| Molecular Weight | 263.77 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (5E,8R)-1-benzyl-8-chloro-3,4,7,8-tetrahydro-2H-azonin-9-one |
| SMILES | O=C1[C@H](Cl)C/C=C/CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C15H18ClNO/c16-14-10-6-1-2-7-11-17(15(14)18)12-13-8-4-3-5-9-13/h1,3-6,8-9,14H,2,7,10-12H2/b6-1+/t14-/m1/s1 |
| InChIKey | ULKLGJQXSSZIPU-BVUGVZOXSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|