C16H20Cl4N2O2 — CID 15128
2,2-dichloro-N-[[4-[[(2,2-dichloroacetyl)-ethylamino]methyl]phenyl]methyl]-N-ethylacetamide (PubChem CID 15128) has the molecular formula C16H20Cl4N2O2 and a molecular weight of 414.16 g/mol. Its IUPAC name is 2,2-dichloro-N-[[4-[[(2,2-dichloroacetyl)-ethylamino]methyl]phenyl]methyl]-N-ethylacetamide.
| Compound Name | 2,2-dichloro-N-[[4-[[(2,2-dichloroacetyl)-ethylamino]methyl]phenyl]methyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 15128 |
| Molecular Formula | C16H20Cl4N2O2 |
| Molecular Weight | 414.16 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2,2-dichloro-N-[[4-[[(2,2-dichloroacetyl)-ethylamino]methyl]phenyl]methyl]-N-ethylacetamide |
| SMILES | CCN(Cc1ccc(CN(CC)C(=O)C(Cl)Cl)cc1)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C16H20Cl4N2O2/c1-3-21(15(23)13(17)18)9-11-5-7-12(8-6-11)10-22(4-2)16(24)14(19)20/h5-8,13-14H,3-4,9-10H2,1-2H3 |
| InChIKey | AEHLRHNHBHGHBT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|